C22H35N5O — CID 171362688
6-[[6-[(1-methylpiperidin-4-yl)methylamino]-3-pyridinyl]methylamino]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-one (PubChem CID 171362688) has the molecular formula C22H35N5O and a molecular weight of 385.56 g/mol. Its IUPAC name is 6-[[6-[(1-methylpiperidin-4-yl)methylamino]-3-pyridinyl]methylamino]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-one.
| Compound Name | 6-[[6-[(1-methylpiperidin-4-yl)methylamino]-3-pyridinyl]methylamino]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-one |
|---|---|
| PubChem CID | 171362688 |
| Molecular Formula | C22H35N5O |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 6-[[6-[(1-methylpiperidin-4-yl)methylamino]-3-pyridinyl]methylamino]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-one |
| SMILES | CN1CCC(CNc2ccc(CNC3CCC4CNC(=O)CC4C3)cn2)CC1 |
| InChI | InChI=1S/C22H35N5O/c1-27-8-6-16(7-9-27)12-24-21-5-2-17(14-25-21)13-23-20-4-3-18-15-26-22(28)11-19(18)10-20/h2,5,14,16,18-20,23H,3-4,6-13,15H2,1H3,(H,24,25)(H,26,28) |
| InChIKey | IVGBRZYJDQAEEH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |