C17H18BrN3O — CID 171364209
N-[(E)-[1-(4-bromophenyl)-2,2-dimethylpropylidene]amino]pyridine-2-carboxamide (PubChem CID 171364209) has the molecular formula C17H18BrN3O and a molecular weight of 360.26 g/mol. Its IUPAC name is N-[(E)-[1-(4-bromophenyl)-2,2-dimethylpropylidene]amino]pyridine-2-carboxamide.
| Compound Name | N-[(E)-[1-(4-bromophenyl)-2,2-dimethylpropylidene]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171364209 |
| Molecular Formula | C17H18BrN3O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[(E)-[1-(4-bromophenyl)-2,2-dimethylpropylidene]amino]pyridine-2-carboxamide |
| SMILES | CC(C)(C)/C(=N\NC(=O)c1ccccn1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrN3O/c1-17(2,3)15(12-7-9-13(18)10-8-12)20-21-16(22)14-6-4-5-11-19-14/h4-11H,1-3H3,(H,21,22)/b20-15- |
| InChIKey | ZGRGJEOBPDRGDY-HKWRFOASSA-N |
| XLogP | 4.02 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|