About [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol
[2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol (PubChem CID 171364630) has the molecular formula C12H10F4N2O
and a molecular weight of 274.22 g/mol. Its IUPAC name is [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol.
Molecular Properties
| Compound Name | [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol |
| PubChem CID | 171364630 |
| Molecular Formula | C12H10F4N2O |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol |
| SMILES | OCc1cccc(-c2cnn(CC(F)(F)F)c2)c1F |
| InChI | InChI=1S/C12H10F4N2O/c13-11-8(6-19)2-1-3-10(11)9-4-17-18(5-9)7-12(14,15)16/h1-5,19H,6-7H2 |
| InChIKey | GYIPOLDIPIWTTB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol?
The IUPAC name of [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol (CID 171364630) is [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol.
What is the SMILES notation for [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol?
The canonical SMILES for [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol is OCc1cccc(-c2cnn(CC(F)(F)F)c2)c1F.
What is the InChIKey of [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol?
The InChIKey is GYIPOLDIPIWTTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F4N2O/c13-11-8(6-19)2-1-3-10(11)9-4-17-18(5-9)7-12(14,15)16/h1-5,19H,6-7H2.
What are the key properties of [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol?
[2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol has a molecular weight of 274.22 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]phenyl]methanol is sourced from PubChem (CID 171364630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).