C30H24N6O4S — CID 171365050
2-[[5-(1H-indol-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-[(E)-3-(3-nitrophenyl)prop-2-enoyl]phenyl]acetamide (PubChem CID 171365050) has the molecular formula C30H24N6O4S and a molecular weight of 564.63 g/mol. Its IUPAC name is 2-[[5-(1H-indol-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-[(E)-3-(3-nitrophenyl)prop-2-enoyl]phenyl]acetamide.
| Compound Name | 2-[[5-(1H-indol-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-[(E)-3-(3-nitrophenyl)prop-2-enoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 171365050 |
| Molecular Formula | C30H24N6O4S |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | 2-[[5-(1H-indol-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-[(E)-3-(3-nitrophenyl)prop-2-enoyl]phenyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(C(=O)/C=C/c3cccc([N+](=O)[O-])c3)cc2)nnc1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C30H24N6O4S/c1-2-16-35-29(25-18-31-26-9-4-3-8-24(25)26)33-34-30(35)41-19-28(38)32-22-13-11-21(12-14-22)27(37)15-10-20-6-5-7-23(17-20)36(39)40/h2-15,17-18,31H,1,16,19H2,(H,32,38)/b15-10+ |
| InChIKey | OAAZTWYEPHBYPS-XNTDXEJSSA-N |
| XLogP | 6.15 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|