C20H3F13 — CID 171365948
2,3,4,5,7,8-hexafluoro-7-(2,3,5,6-tetrafluorophenyl)-8-(2,4,6-trifluorophenyl)bicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 171365948) has the molecular formula C20H3F13 and a molecular weight of 490.22 g/mol. Its IUPAC name is 2,3,4,5,7,8-hexafluoro-7-(2,3,5,6-tetrafluorophenyl)-8-(2,4,6-trifluorophenyl)bicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 2,3,4,5,7,8-hexafluoro-7-(2,3,5,6-tetrafluorophenyl)-8-(2,4,6-trifluorophenyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 171365948 |
| Molecular Formula | C20H3F13 |
| Molecular Weight | 490.22 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 2,3,4,5,7,8-hexafluoro-7-(2,3,5,6-tetrafluorophenyl)-8-(2,4,6-trifluorophenyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | Fc1cc(F)c(C2(F)c3c(F)c(F)c(F)c(F)c3C2(F)c2c(F)c(F)cc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C20H3F13/c21-4-1-5(22)9(6(23)2-4)19(32)10-11(16(29)18(31)17(30)15(10)28)20(19,33)12-13(26)7(24)3-8(25)14(12)27/h1-3H |
| InChIKey | HGDWGSVSJPODMB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.22 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|