(2,3-dichloro-4-methylsulfanylphenyl)boronic acid

C7H7BCl2O2S — CID 171366561

IUPAC(2,3-dichloro-4-methylsulfanylphenyl)boronic acid
SMILESCSc1ccc(B(O)O)c(Cl)c1Cl
InChIInChI=1S/C7H7BCl2O2S/c1-13-5-3-2-4(8(11)12)6(9)7(5)10/h2-3,11-12H,1H3
InChIKeyWCLDQHWAEGEKHA-UHFFFAOYSA-N
MW236.92 g/mol
LogP1.40
Rot. Bonds2

About (2,3-dichloro-4-methylsulfanylphenyl)boronic acid

(2,3-dichloro-4-methylsulfanylphenyl)boronic acid (PubChem CID 171366561) has the molecular formula C7H7BCl2O2S and a molecular weight of 236.92 g/mol. Its IUPAC name is (2,3-dichloro-4-methylsulfanylphenyl)boronic acid.

Molecular Properties

Compound Name(2,3-dichloro-4-methylsulfanylphenyl)boronic acid
PubChem CID171366561
Molecular FormulaC7H7BCl2O2S
Molecular Weight236.92 g/mol
Exact Mass235.96
IUPAC Name(2,3-dichloro-4-methylsulfanylphenyl)boronic acid
SMILESCSc1ccc(B(O)O)c(Cl)c1Cl
InChIInChI=1S/C7H7BCl2O2S/c1-13-5-3-2-4(8(11)12)6(9)7(5)10/h2-3,11-12H,1H3
InChIKeyWCLDQHWAEGEKHA-UHFFFAOYSA-N
XLogP1.40
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.92
LogP ≤ 51.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2,3-dichloro-4-methylsulfanylphenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2,3-dichloro-4-methylsulfanylbenzoic acid
CID 14745482
(4-fluoro-2-methylsulfanylphenyl)boronic acid
CID 53216523
(4-chloro-2-fluoro-3-methylsulfanylphenyl)boronic acid
CID 66954319
(2-chloro-6-methylsulfanylphenyl)boronic acid
CID 151722806
(3-chloro-2-fluoro-4-methylphenyl)boronic acid
CID 134128504
(2-chloro-6-fluoro-3-methylsulfanylphenyl)methanol
CID 171367252
(2-chloro-3-fluoro-4-formylphenyl)boronic acid
CID 131676996
(E)-4-(2,3-dichloro-4-methylsulfanylphenyl)but-3-en-2-one
CID 20765629
1-chloro-2-methylsulfanylnaphthalene
CID 15311205
(2,4-dichloro-3-formylphenyl)boronic acid
CID 130058693
2-chloro-3-methylsulfanylbenzaldehyde
CID 131318711
(3-chloro-2-fluoro-4-formylphenyl)boronic acid
CID 164891758

Frequently Asked Questions

What is the IUPAC name of (2,3-dichloro-4-methylsulfanylphenyl)boronic acid?
The IUPAC name of (2,3-dichloro-4-methylsulfanylphenyl)boronic acid (CID 171366561) is (2,3-dichloro-4-methylsulfanylphenyl)boronic acid.
What is the SMILES notation for (2,3-dichloro-4-methylsulfanylphenyl)boronic acid?
The canonical SMILES for (2,3-dichloro-4-methylsulfanylphenyl)boronic acid is CSc1ccc(B(O)O)c(Cl)c1Cl.
What is the InChIKey of (2,3-dichloro-4-methylsulfanylphenyl)boronic acid?
The InChIKey is WCLDQHWAEGEKHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BCl2O2S/c1-13-5-3-2-4(8(11)12)6(9)7(5)10/h2-3,11-12H,1H3.
What are the key properties of (2,3-dichloro-4-methylsulfanylphenyl)boronic acid?
(2,3-dichloro-4-methylsulfanylphenyl)boronic acid has a molecular weight of 236.92 g/mol, XLogP of 1.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dichloro-4-methylsulfanylphenyl)boronic acid is sourced from PubChem (CID 171366561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).