C11H10Cl2OS — CID 20765629
(E)-4-(2,3-dichloro-4-methylsulfanylphenyl)but-3-en-2-one (PubChem CID 20765629) has the molecular formula C11H10Cl2OS and a molecular weight of 261.17 g/mol. Its IUPAC name is (E)-4-(2,3-dichloro-4-methylsulfanylphenyl)but-3-en-2-one.
| Compound Name | (E)-4-(2,3-dichloro-4-methylsulfanylphenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 20765629 |
| Molecular Formula | C11H10Cl2OS |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | (E)-4-(2,3-dichloro-4-methylsulfanylphenyl)but-3-en-2-one |
| SMILES | CSc1ccc(/C=C/C(C)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl2OS/c1-7(14)3-4-8-5-6-9(15-2)11(13)10(8)12/h3-6H,1-2H3/b4-3+ |
| InChIKey | ZCQYBAUSROSIDH-ONEGZZNKSA-N |
| XLogP | 4.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|