C35H35FN2O9 — CID 171370497
bis((Z)-but-2-enedioic acid);1-(3-fluoro-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)-4-(1-phenylprop-1-en-2-yl)piperazine (PubChem CID 171370497) has the molecular formula C35H35FN2O9 and a molecular weight of 646.67 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);1-(3-fluoro-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)-4-(1-phenylprop-1-en-2-yl)piperazine.
| Compound Name | bis((Z)-but-2-enedioic acid);1-(3-fluoro-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)-4-(1-phenylprop-1-en-2-yl)piperazine |
|---|---|
| PubChem CID | 171370497 |
| Molecular Formula | C35H35FN2O9 |
| Molecular Weight | 646.67 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);1-(3-fluoro-6,11-dihydrobenzo[c][1]benzoxepin-11-yl)-4-(1-phenylprop-1-en-2-yl)piperazine |
| SMILES | CC(=Cc1ccccc1)N1CCN(C2c3ccccc3COc3cc(F)ccc32)CC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C27H27FN2O.2C4H4O4/c1-20(17-21-7-3-2-4-8-21)29-13-15-30(16-14-29)27-24-10-6-5-9-22(24)19-31-26-18-23(28)11-12-25(26)27;2*5-3(6)1-2-4(7)8/h2-12,17-18,27H,13-16,19H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | YMRUECAMPHWJPA-SPIKMXEPSA-N |
| XLogP | 4.91 |
| TPSA | 164.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|