About 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride
1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride (PubChem CID 171375281) has the molecular formula C18H15ClN2O
and a molecular weight of 310.78 g/mol. Its IUPAC name is 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride |
| PubChem CID | 171375281 |
| Molecular Formula | C18H15ClN2O |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride |
| SMILES | CC(=O)c1cn2ccc3c4ccccc4nc-3c2cc1C.Cl |
| InChI | InChI=1S/C18H14N2O.ClH/c1-11-9-17-18-14(13-5-3-4-6-16(13)19-18)7-8-20(17)10-15(11)12(2)21;/h3-10H,1-2H3;1H |
| InChIKey | ZNSCHNRWSIJUQF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride?
The IUPAC name of 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride (CID 171375281) is 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride.
What is the SMILES notation for 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride?
The canonical SMILES for 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride is CC(=O)c1cn2ccc3c4ccccc4nc-3c2cc1C.Cl.
What is the InChIKey of 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride?
The InChIKey is ZNSCHNRWSIJUQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O.ClH/c1-11-9-17-18-14(13-5-3-4-6-16(13)19-18)7-8-20(17)10-15(11)12(2)21;/h3-10H,1-2H3;1H.
What are the key properties of 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride?
1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride has a molecular weight of 310.78 g/mol, XLogP of 4.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylindolo[2,3-a]quinolizin-3-yl)ethanone;hydrochloride is sourced from PubChem (CID 171375281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).