C22H16N8O4 — CID 171376475
1-N,1-N-bis[(E)-(2-nitrophenyl)methylideneamino]phthalazine-1,4-diamine (PubChem CID 171376475) has the molecular formula C22H16N8O4 and a molecular weight of 456.42 g/mol. Its IUPAC name is 1-N,1-N-bis[(E)-(2-nitrophenyl)methylideneamino]phthalazine-1,4-diamine.
| Compound Name | 1-N,1-N-bis[(E)-(2-nitrophenyl)methylideneamino]phthalazine-1,4-diamine |
|---|---|
| PubChem CID | 171376475 |
| Molecular Formula | C22H16N8O4 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 1-N,1-N-bis[(E)-(2-nitrophenyl)methylideneamino]phthalazine-1,4-diamine |
| SMILES | Nc1nnc(N(/N=C/c2ccccc2[N+](=O)[O-])/N=C/c2ccccc2[N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C22H16N8O4/c23-21-17-9-3-4-10-18(17)22(27-26-21)28(24-13-15-7-1-5-11-19(15)29(31)32)25-14-16-8-2-6-12-20(16)30(33)34/h1-14H,(H2,23,26)/b24-13+,25-14+ |
| InChIKey | ZLSKIAGBIOELHX-GUJRAXHGSA-N |
| XLogP | 3.90 |
| TPSA | 166.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|