C26H52O3Si — CID 171379460
ethyl (Z)-3-[tert-butyl(dimethyl)silyl]oxyoctadec-9-enoate (PubChem CID 171379460) has the molecular formula C26H52O3Si and a molecular weight of 440.79 g/mol. Its IUPAC name is ethyl (Z)-3-[tert-butyl(dimethyl)silyl]oxyoctadec-9-enoate.
| Compound Name | ethyl (Z)-3-[tert-butyl(dimethyl)silyl]oxyoctadec-9-enoate |
|---|---|
| PubChem CID | 171379460 |
| Molecular Formula | C26H52O3Si |
| Molecular Weight | 440.79 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | ethyl (Z)-3-[tert-butyl(dimethyl)silyl]oxyoctadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCC(CC(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O3Si/c1-8-10-11-12-13-14-15-16-17-18-19-20-21-22-24(23-25(27)28-9-2)29-30(6,7)26(3,4)5/h16-17,24H,8-15,18-23H2,1-7H3/b17-16- |
| InChIKey | RQSRPHBEEICWLR-MSUUIHNZSA-N |
| XLogP | 8.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.79 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|