C47H48N4O10S2 — CID 171381529
cyclopentyl N-[2,3-bis[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-1-(trideuteriomethyl)indol-5-yl]carbamate (PubChem CID 171381529) has the molecular formula C47H48N4O10S2 and a molecular weight of 896.07 g/mol. Its IUPAC name is cyclopentyl N-[2,3-bis[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-1-(trideuteriomethyl)indol-5-yl]carbamate.
| Compound Name | cyclopentyl N-[2,3-bis[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-1-(trideuteriomethyl)indol-5-yl]carbamate |
|---|---|
| PubChem CID | 171381529 |
| Molecular Formula | C47H48N4O10S2 |
| Molecular Weight | 896.07 g/mol |
| Exact Mass | 895.30 |
| IUPAC Name | cyclopentyl N-[2,3-bis[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-1-(trideuteriomethyl)indol-5-yl]carbamate |
| SMILES | [2H]C([2H])([2H])n1c(Cc2ccc(C(=O)NS(=O)(=O)c3ccccc3C)cc2OC)c(Cc2ccc(C(=O)NS(=O)(=O)c3ccccc3C)cc2OC)c2cc(NC(=O)OC3CCCC3)ccc21 |
| InChI | InChI=1S/C47H48N4O10S2/c1-29-12-6-10-16-43(29)62(55,56)49-45(52)33-20-18-31(41(26-33)59-4)24-37-38-28-35(48-47(54)61-36-14-8-9-15-36)22-23-39(38)51(3)40(37)25-32-19-21-34(27-42(32)60-5)46(53)50-63(57,58)44-17-11-7-13-30(44)2/h6-7,10-13,16-23,26-28,36H,8-9,14-15,24-25H2,1-5H3,(H,48,54)(H,49,52)(H,50,53)/i3D3 |
| InChIKey | QHVKPPJUNIXANB-HPRDVNIFSA-N |
| XLogP | 7.72 |
| TPSA | 188.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.07 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|