C31H33N3O6S — CID 69084803
cyclopentyl N-[3-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-2-methyl-1H-indol-5-yl]carbamate (PubChem CID 69084803) has the molecular formula C31H33N3O6S and a molecular weight of 575.69 g/mol. Its IUPAC name is cyclopentyl N-[3-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-2-methyl-1H-indol-5-yl]carbamate.
| Compound Name | cyclopentyl N-[3-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-2-methyl-1H-indol-5-yl]carbamate |
|---|---|
| PubChem CID | 69084803 |
| Molecular Formula | C31H33N3O6S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | cyclopentyl N-[3-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-2-methyl-1H-indol-5-yl]carbamate |
| SMILES | COc1cc(C(=O)NS(=O)(=O)c2ccccc2C)ccc1Cc1c(C)[nH]c2ccc(NC(=O)OC3CCCC3)cc12 |
| InChI | InChI=1S/C31H33N3O6S/c1-19-8-4-7-11-29(19)41(37,38)34-30(35)22-13-12-21(28(17-22)39-3)16-25-20(2)32-27-15-14-23(18-26(25)27)33-31(36)40-24-9-5-6-10-24/h4,7-8,11-15,17-18,24,32H,5-6,9-10,16H2,1-3H3,(H,33,36)(H,34,35) |
| InChIKey | KMOXFLCXNDJQQP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|