C27H28N2O7S — CID 14763140
cyclopentyl N-[3-[[4-(benzenesulfonylcarbamoyl)-2-methoxyphenyl]methoxy]phenyl]carbamate (PubChem CID 14763140) has the molecular formula C27H28N2O7S and a molecular weight of 524.60 g/mol. Its IUPAC name is cyclopentyl N-[3-[[4-(benzenesulfonylcarbamoyl)-2-methoxyphenyl]methoxy]phenyl]carbamate.
| Compound Name | cyclopentyl N-[3-[[4-(benzenesulfonylcarbamoyl)-2-methoxyphenyl]methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 14763140 |
| Molecular Formula | C27H28N2O7S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | cyclopentyl N-[3-[[4-(benzenesulfonylcarbamoyl)-2-methoxyphenyl]methoxy]phenyl]carbamate |
| SMILES | COc1cc(C(=O)NS(=O)(=O)c2ccccc2)ccc1COc1cccc(NC(=O)OC2CCCC2)c1 |
| InChI | InChI=1S/C27H28N2O7S/c1-34-25-16-19(26(30)29-37(32,33)24-12-3-2-4-13-24)14-15-20(25)18-35-23-11-7-8-21(17-23)28-27(31)36-22-9-5-6-10-22/h2-4,7-8,11-17,22H,5-6,9-10,18H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | VAZCQOYFVVSLSG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |