C31H31N3O8S — CID 14753018
methyl 2-(benzenesulfonyl)-3-[4-[[6-(cyclopentyloxycarbonylamino)indazol-1-yl]methyl]-3-methoxyphenyl]-3-oxopropanoate (PubChem CID 14753018) has the molecular formula C31H31N3O8S and a molecular weight of 605.67 g/mol. Its IUPAC name is methyl 2-(benzenesulfonyl)-3-[4-[[6-(cyclopentyloxycarbonylamino)indazol-1-yl]methyl]-3-methoxyphenyl]-3-oxopropanoate.
| Compound Name | methyl 2-(benzenesulfonyl)-3-[4-[[6-(cyclopentyloxycarbonylamino)indazol-1-yl]methyl]-3-methoxyphenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 14753018 |
| Molecular Formula | C31H31N3O8S |
| Molecular Weight | 605.67 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | methyl 2-(benzenesulfonyl)-3-[4-[[6-(cyclopentyloxycarbonylamino)indazol-1-yl]methyl]-3-methoxyphenyl]-3-oxopropanoate |
| SMILES | COC(=O)C(C(=O)c1ccc(Cn2ncc3ccc(NC(=O)OC4CCCC4)cc32)c(OC)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H31N3O8S/c1-40-27-16-20(28(35)29(30(36)41-2)43(38,39)25-10-4-3-5-11-25)12-13-22(27)19-34-26-17-23(15-14-21(26)18-32-34)33-31(37)42-24-8-6-7-9-24/h3-5,10-18,24,29H,6-9,19H2,1-2H3,(H,33,37) |
| InChIKey | CDMNZNNPWJEINU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 142.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|