C27H28N4O6S — CID 14753015
butyl N-[1-[[4-(benzenesulfonylcarbamoyl)-2-methoxyphenyl]methyl]indazol-6-yl]carbamate (PubChem CID 14753015) has the molecular formula C27H28N4O6S and a molecular weight of 536.61 g/mol. Its IUPAC name is butyl N-[1-[[4-(benzenesulfonylcarbamoyl)-2-methoxyphenyl]methyl]indazol-6-yl]carbamate.
| Compound Name | butyl N-[1-[[4-(benzenesulfonylcarbamoyl)-2-methoxyphenyl]methyl]indazol-6-yl]carbamate |
|---|---|
| PubChem CID | 14753015 |
| Molecular Formula | C27H28N4O6S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | butyl N-[1-[[4-(benzenesulfonylcarbamoyl)-2-methoxyphenyl]methyl]indazol-6-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc2cnn(Cc3ccc(C(=O)NS(=O)(=O)c4ccccc4)cc3OC)c2c1 |
| InChI | InChI=1S/C27H28N4O6S/c1-3-4-14-37-27(33)29-22-13-12-20-17-28-31(24(20)16-22)18-21-11-10-19(15-25(21)36-2)26(32)30-38(34,35)23-8-6-5-7-9-23/h5-13,15-17H,3-4,14,18H2,1-2H3,(H,29,33)(H,30,32) |
| InChIKey | RQYKCOHESWJAEH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|