C22H25N3O4 — CID 14708683
4-[[7-(hexanoylamino)indazol-1-yl]methyl]-3-methoxybenzoic acid (PubChem CID 14708683) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-[[7-(hexanoylamino)indazol-1-yl]methyl]-3-methoxybenzoic acid.
| Compound Name | 4-[[7-(hexanoylamino)indazol-1-yl]methyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 14708683 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 4-[[7-(hexanoylamino)indazol-1-yl]methyl]-3-methoxybenzoic acid |
| SMILES | CCCCCC(=O)Nc1cccc2cnn(Cc3ccc(C(=O)O)cc3OC)c12 |
| InChI | InChI=1S/C22H25N3O4/c1-3-4-5-9-20(26)24-18-8-6-7-16-13-23-25(21(16)18)14-17-11-10-15(22(27)28)12-19(17)29-2/h6-8,10-13H,3-5,9,14H2,1-2H3,(H,24,26)(H,27,28) |
| InChIKey | OQZSIEWLSJLJCI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|