C24H28N2O4 — CID 14708767
methyl 4-[[6-(hexanoylamino)indol-1-yl]methyl]-3-methoxybenzoate (PubChem CID 14708767) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is methyl 4-[[6-(hexanoylamino)indol-1-yl]methyl]-3-methoxybenzoate.
| Compound Name | methyl 4-[[6-(hexanoylamino)indol-1-yl]methyl]-3-methoxybenzoate |
|---|---|
| PubChem CID | 14708767 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | methyl 4-[[6-(hexanoylamino)indol-1-yl]methyl]-3-methoxybenzoate |
| SMILES | CCCCCC(=O)Nc1ccc2ccn(Cc3ccc(C(=O)OC)cc3OC)c2c1 |
| InChI | InChI=1S/C24H28N2O4/c1-4-5-6-7-23(27)25-20-11-10-17-12-13-26(21(17)15-20)16-19-9-8-18(24(28)30-3)14-22(19)29-2/h8-15H,4-7,16H2,1-3H3,(H,25,27) |
| InChIKey | XKHIWHDCXCSNHL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|