C26H30N2O4 — CID 14882505
methyl 4-[[6-[2-(cyclopentylmethylamino)-2-oxoethyl]indol-1-yl]methyl]-3-methoxybenzoate (PubChem CID 14882505) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is methyl 4-[[6-[2-(cyclopentylmethylamino)-2-oxoethyl]indol-1-yl]methyl]-3-methoxybenzoate.
| Compound Name | methyl 4-[[6-[2-(cyclopentylmethylamino)-2-oxoethyl]indol-1-yl]methyl]-3-methoxybenzoate |
|---|---|
| PubChem CID | 14882505 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | methyl 4-[[6-[2-(cyclopentylmethylamino)-2-oxoethyl]indol-1-yl]methyl]-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(Cn2ccc3ccc(CC(=O)NCC4CCCC4)cc32)c(OC)c1 |
| InChI | InChI=1S/C26H30N2O4/c1-31-24-15-21(26(30)32-2)9-10-22(24)17-28-12-11-20-8-7-19(13-23(20)28)14-25(29)27-16-18-5-3-4-6-18/h7-13,15,18H,3-6,14,16-17H2,1-2H3,(H,27,29) |
| InChIKey | DBQFGNBOEXBXEB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|