C31H34N4O7S — CID 14753063
4-[[6-(2-ethylhexanoylamino)indol-1-yl]methyl]-3-methoxy-N-(4-nitrophenyl)sulfonylbenzamide (PubChem CID 14753063) has the molecular formula C31H34N4O7S and a molecular weight of 606.70 g/mol. Its IUPAC name is 4-[[6-(2-ethylhexanoylamino)indol-1-yl]methyl]-3-methoxy-N-(4-nitrophenyl)sulfonylbenzamide.
| Compound Name | 4-[[6-(2-ethylhexanoylamino)indol-1-yl]methyl]-3-methoxy-N-(4-nitrophenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 14753063 |
| Molecular Formula | C31H34N4O7S |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 4-[[6-(2-ethylhexanoylamino)indol-1-yl]methyl]-3-methoxy-N-(4-nitrophenyl)sulfonylbenzamide |
| SMILES | CCCCC(CC)C(=O)Nc1ccc2ccn(Cc3ccc(C(=O)NS(=O)(=O)c4ccc([N+](=O)[O-])cc4)cc3OC)c2c1 |
| InChI | InChI=1S/C31H34N4O7S/c1-4-6-7-21(5-2)30(36)32-25-11-10-22-16-17-34(28(22)19-25)20-24-9-8-23(18-29(24)42-3)31(37)33-43(40,41)27-14-12-26(13-15-27)35(38)39/h8-19,21H,4-7,20H2,1-3H3,(H,32,36)(H,33,37) |
| InChIKey | YRWCQAPUCJYHEU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 149.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|