C16H24N2O4S — CID 7801539
(2S)-N-[4-(acetylsulfamoyl)phenyl]-2-ethylhexanamide (PubChem CID 7801539) has the molecular formula C16H24N2O4S and a molecular weight of 340.44 g/mol. Its IUPAC name is (2S)-N-[4-(acetylsulfamoyl)phenyl]-2-ethylhexanamide.
| Compound Name | (2S)-N-[4-(acetylsulfamoyl)phenyl]-2-ethylhexanamide |
|---|---|
| PubChem CID | 7801539 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (2S)-N-[4-(acetylsulfamoyl)phenyl]-2-ethylhexanamide |
| SMILES | CCCC[C@H](CC)C(=O)Nc1ccc(S(=O)(=O)NC(C)=O)cc1 |
| InChI | InChI=1S/C16H24N2O4S/c1-4-6-7-13(5-2)16(20)17-14-8-10-15(11-9-14)23(21,22)18-12(3)19/h8-11,13H,4-7H2,1-3H3,(H,17,20)(H,18,19)/t13-/m0/s1 |
| InChIKey | UYGPNXHYDXTVLM-ZDUSSCGKSA-N |
| XLogP | 2.67 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |