C26H32N2O4 — CID 23365894
methyl 4-[[5-(2-ethylhexanoylamino)-1H-indol-3-yl]methyl]-3-methoxybenzoate (PubChem CID 23365894) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is methyl 4-[[5-(2-ethylhexanoylamino)-1H-indol-3-yl]methyl]-3-methoxybenzoate.
| Compound Name | methyl 4-[[5-(2-ethylhexanoylamino)-1H-indol-3-yl]methyl]-3-methoxybenzoate |
|---|---|
| PubChem CID | 23365894 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | methyl 4-[[5-(2-ethylhexanoylamino)-1H-indol-3-yl]methyl]-3-methoxybenzoate |
| SMILES | CCCCC(CC)C(=O)Nc1ccc2[nH]cc(Cc3ccc(C(=O)OC)cc3OC)c2c1 |
| InChI | InChI=1S/C26H32N2O4/c1-5-7-8-17(6-2)25(29)28-21-11-12-23-22(15-21)20(16-27-23)13-18-9-10-19(26(30)32-4)14-24(18)31-3/h9-12,14-17,27H,5-8,13H2,1-4H3,(H,28,29) |
| InChIKey | YMEQWNQVXTZRAW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |