C28H34N2O5 — CID 19744318
methyl 4-[[3-acetyl-6-(2-ethylhexanoylamino)indol-1-yl]methyl]-3-methoxybenzoate (PubChem CID 19744318) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is methyl 4-[[3-acetyl-6-(2-ethylhexanoylamino)indol-1-yl]methyl]-3-methoxybenzoate.
| Compound Name | methyl 4-[[3-acetyl-6-(2-ethylhexanoylamino)indol-1-yl]methyl]-3-methoxybenzoate |
|---|---|
| PubChem CID | 19744318 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | methyl 4-[[3-acetyl-6-(2-ethylhexanoylamino)indol-1-yl]methyl]-3-methoxybenzoate |
| SMILES | CCCCC(CC)C(=O)Nc1ccc2c(C(C)=O)cn(Cc3ccc(C(=O)OC)cc3OC)c2c1 |
| InChI | InChI=1S/C28H34N2O5/c1-6-8-9-19(7-2)27(32)29-22-12-13-23-24(18(3)31)17-30(25(23)15-22)16-21-11-10-20(28(33)35-5)14-26(21)34-4/h10-15,17,19H,6-9,16H2,1-5H3,(H,29,32) |
| InChIKey | WRPDJDUPOKSCAG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |