C26H25N3O4 — CID 23365898
3-methoxy-4-[[6-(2-phenylbutanoylamino)benzimidazol-1-yl]methyl]benzoic acid (PubChem CID 23365898) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 3-methoxy-4-[[6-(2-phenylbutanoylamino)benzimidazol-1-yl]methyl]benzoic acid.
| Compound Name | 3-methoxy-4-[[6-(2-phenylbutanoylamino)benzimidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 23365898 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 3-methoxy-4-[[6-(2-phenylbutanoylamino)benzimidazol-1-yl]methyl]benzoic acid |
| SMILES | CCC(C(=O)Nc1ccc2ncn(Cc3ccc(C(=O)O)cc3OC)c2c1)c1ccccc1 |
| InChI | InChI=1S/C26H25N3O4/c1-3-21(17-7-5-4-6-8-17)25(30)28-20-11-12-22-23(14-20)29(16-27-22)15-19-10-9-18(26(31)32)13-24(19)33-2/h4-14,16,21H,3,15H2,1-2H3,(H,28,30)(H,31,32) |
| InChIKey | JKABJCUWEYPISR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |