C31H34N2O4 — CID 19744308
methyl 3-methoxy-4-[[2,3,5-trimethyl-6-(2-phenylbutanoylamino)indol-1-yl]methyl]benzoate (PubChem CID 19744308) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is methyl 3-methoxy-4-[[2,3,5-trimethyl-6-(2-phenylbutanoylamino)indol-1-yl]methyl]benzoate.
| Compound Name | methyl 3-methoxy-4-[[2,3,5-trimethyl-6-(2-phenylbutanoylamino)indol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 19744308 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | methyl 3-methoxy-4-[[2,3,5-trimethyl-6-(2-phenylbutanoylamino)indol-1-yl]methyl]benzoate |
| SMILES | CCC(C(=O)Nc1cc2c(cc1C)c(C)c(C)n2Cc1ccc(C(=O)OC)cc1OC)c1ccccc1 |
| InChI | InChI=1S/C31H34N2O4/c1-7-25(22-11-9-8-10-12-22)30(34)32-27-17-28-26(15-19(27)2)20(3)21(4)33(28)18-24-14-13-23(31(35)37-6)16-29(24)36-5/h8-17,25H,7,18H2,1-6H3,(H,32,34) |
| InChIKey | JHXWKSZJGQSYCU-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|