C30H29N3O6S — CID 67745389
3-[4-[[6-(cyclopentyloxycarbonylamino)indazol-1-yl]methyl]-3-methoxyphenyl]-3-oxo-2-phenylsulfanylpropanoic acid (PubChem CID 67745389) has the molecular formula C30H29N3O6S and a molecular weight of 559.64 g/mol. Its IUPAC name is 3-[4-[[6-(cyclopentyloxycarbonylamino)indazol-1-yl]methyl]-3-methoxyphenyl]-3-oxo-2-phenylsulfanylpropanoic acid.
| Compound Name | 3-[4-[[6-(cyclopentyloxycarbonylamino)indazol-1-yl]methyl]-3-methoxyphenyl]-3-oxo-2-phenylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 67745389 |
| Molecular Formula | C30H29N3O6S |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 3-[4-[[6-(cyclopentyloxycarbonylamino)indazol-1-yl]methyl]-3-methoxyphenyl]-3-oxo-2-phenylsulfanylpropanoic acid |
| SMILES | COc1cc(C(=O)C(Sc2ccccc2)C(=O)O)ccc1Cn1ncc2ccc(NC(=O)OC3CCCC3)cc21 |
| InChI | InChI=1S/C30H29N3O6S/c1-38-26-15-19(27(34)28(29(35)36)40-24-9-3-2-4-10-24)11-12-21(26)18-33-25-16-22(14-13-20(25)17-31-33)32-30(37)39-23-7-5-6-8-23/h2-4,9-17,23,28H,5-8,18H2,1H3,(H,32,37)(H,35,36) |
| InChIKey | SDOPGLYUXZGLFT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|