C28H29N5O2 — CID 171381922
2-[2-[2,2,3,3,5,5,6,6-octadeuterio-4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoethyl]-4-(pyridin-4-ylmethyl)phthalazin-1-one (PubChem CID 171381922) has the molecular formula C28H29N5O2 and a molecular weight of 475.62 g/mol. Its IUPAC name is 2-[2-[2,2,3,3,5,5,6,6-octadeuterio-4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoethyl]-4-(pyridin-4-ylmethyl)phthalazin-1-one.
| Compound Name | 2-[2-[2,2,3,3,5,5,6,6-octadeuterio-4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoethyl]-4-(pyridin-4-ylmethyl)phthalazin-1-one |
|---|---|
| PubChem CID | 171381922 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | 2-[2-[2,2,3,3,5,5,6,6-octadeuterio-4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoethyl]-4-(pyridin-4-ylmethyl)phthalazin-1-one |
| SMILES | [2H]C1([2H])N(C(=O)Cn2nc(Cc3ccncc3)c3ccccc3c2=O)C([2H])([2H])C([2H])([2H])N(c2cccc(C)c2C)C1([2H])[2H] |
| InChI | InChI=1S/C28H29N5O2/c1-20-6-5-9-26(21(20)2)31-14-16-32(17-15-31)27(34)19-33-28(35)24-8-4-3-7-23(24)25(30-33)18-22-10-12-29-13-11-22/h3-13H,14-19H2,1-2H3/i14D2,15D2,16D2,17D2 |
| InChIKey | ZOVSUAVLAHSZHG-AZGHYOHESA-N |
| XLogP | 3.35 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |