C21H22N4O3 — CID 70743963
4-methyl-2-[2-oxo-2-(4-pyridin-4-yloxypiperidin-1-yl)ethyl]phthalazin-1-one (PubChem CID 70743963) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 4-methyl-2-[2-oxo-2-(4-pyridin-4-yloxypiperidin-1-yl)ethyl]phthalazin-1-one.
| Compound Name | 4-methyl-2-[2-oxo-2-(4-pyridin-4-yloxypiperidin-1-yl)ethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 70743963 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 4-methyl-2-[2-oxo-2-(4-pyridin-4-yloxypiperidin-1-yl)ethyl]phthalazin-1-one |
| SMILES | Cc1nn(CC(=O)N2CCC(Oc3ccncc3)CC2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H22N4O3/c1-15-18-4-2-3-5-19(18)21(27)25(23-15)14-20(26)24-12-8-17(9-13-24)28-16-6-10-22-11-7-16/h2-7,10-11,17H,8-9,12-14H2,1H3 |
| InChIKey | UAXBXPQKRFDXIE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |