C21H28N4O4 — CID 90617118
1-[2-oxo-2-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 90617118) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-[2-oxo-2-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-oxo-2-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 90617118 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-[2-oxo-2-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C(CN1C(=O)CCC1=O)N1CCC(N2CCC(Oc3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C21H28N4O4/c26-19-1-2-20(27)25(19)15-21(28)24-11-5-16(6-12-24)23-13-7-18(8-14-23)29-17-3-9-22-10-4-17/h3-4,9-10,16,18H,1-2,5-8,11-15H2 |
| InChIKey | ULZDDTDHMSTBFX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|