C22H33N3O2S — CID 90617346
2-cyclopentylsulfanyl-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone (PubChem CID 90617346) has the molecular formula C22H33N3O2S and a molecular weight of 403.59 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-cyclopentylsulfanyl-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90617346 |
| Molecular Formula | C22H33N3O2S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-cyclopentylsulfanyl-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone |
| SMILES | O=C(CSC1CCCC1)N1CCC(N2CCC(Oc3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C22H33N3O2S/c26-22(17-28-21-3-1-2-4-21)25-13-7-18(8-14-25)24-15-9-20(10-16-24)27-19-5-11-23-12-6-19/h5-6,11-12,18,20-21H,1-4,7-10,13-17H2 |
| InChIKey | BXQJBTGOMASONL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |