C24H31N3O2S — CID 90617160
3-phenylsulfanyl-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]propan-1-one (PubChem CID 90617160) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is 3-phenylsulfanyl-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]propan-1-one.
| Compound Name | 3-phenylsulfanyl-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 90617160 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 3-phenylsulfanyl-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]propan-1-one |
| SMILES | O=C(CCSc1ccccc1)N1CCC(N2CCC(Oc3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C24H31N3O2S/c28-24(12-19-30-23-4-2-1-3-5-23)27-15-8-20(9-16-27)26-17-10-22(11-18-26)29-21-6-13-25-14-7-21/h1-7,13-14,20,22H,8-12,15-19H2 |
| InChIKey | LBWWIARTLWUBPO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |