C25H33N3O4 — CID 90617176
2-(4-ethoxyphenoxy)-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone (PubChem CID 90617176) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-ethoxyphenoxy)-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90617176 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone |
| SMILES | CCOc1ccc(OCC(=O)N2CCC(N3CCC(Oc4ccncc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H33N3O4/c1-2-30-21-3-5-22(6-4-21)31-19-25(29)28-15-9-20(10-16-28)27-17-11-24(12-18-27)32-23-7-13-26-14-8-23/h3-8,13-14,20,24H,2,9-12,15-19H2,1H3 |
| InChIKey | DSDVQKVBYAXYMR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |