C24H31N3O3 — CID 90617132
2-(3-methylphenoxy)-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone (PubChem CID 90617132) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-(3-methylphenoxy)-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(3-methylphenoxy)-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90617132 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 2-(3-methylphenoxy)-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone |
| SMILES | Cc1cccc(OCC(=O)N2CCC(N3CCC(Oc4ccncc4)CC3)CC2)c1 |
| InChI | InChI=1S/C24H31N3O3/c1-19-3-2-4-23(17-19)29-18-24(28)27-13-7-20(8-14-27)26-15-9-22(10-16-26)30-21-5-11-25-12-6-21/h2-6,11-12,17,20,22H,7-10,13-16,18H2,1H3 |
| InChIKey | DAJYCUYHEMVKSV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |