C23H28FN3O2 — CID 90617113
2-(4-fluorophenyl)-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone (PubChem CID 90617113) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90617113 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)N1CCC(N2CCC(Oc3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C23H28FN3O2/c24-19-3-1-18(2-4-19)17-23(28)27-13-7-20(8-14-27)26-15-9-22(10-16-26)29-21-5-11-25-12-6-21/h1-6,11-12,20,22H,7-10,13-17H2 |
| InChIKey | OUUAPMPTTRGRBD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |