C25H33N3O4 — CID 90617275
[4-(2-methoxyethoxy)phenyl]-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]methanone (PubChem CID 90617275) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)phenyl]-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]methanone.
| Compound Name | [4-(2-methoxyethoxy)phenyl]-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 90617275 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | [4-(2-methoxyethoxy)phenyl]-[4-(4-pyridin-4-yloxypiperidin-1-yl)piperidin-1-yl]methanone |
| SMILES | COCCOc1ccc(C(=O)N2CCC(N3CCC(Oc4ccncc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H33N3O4/c1-30-18-19-31-22-4-2-20(3-5-22)25(29)28-14-8-21(9-15-28)27-16-10-24(11-17-27)32-23-6-12-26-13-7-23/h2-7,12-13,21,24H,8-11,14-19H2,1H3 |
| InChIKey | MYINNZQPIDTQMW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|