C24H24Cl3NO — CID 171382118
2-[2-chloro-4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N-ethylethanamine;hydrochloride (PubChem CID 171382118) has the molecular formula C24H24Cl3NO and a molecular weight of 448.82 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N-ethylethanamine;hydrochloride.
| Compound Name | 2-[2-chloro-4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N-ethylethanamine;hydrochloride |
|---|---|
| PubChem CID | 171382118 |
| Molecular Formula | C24H24Cl3NO |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N-ethylethanamine;hydrochloride |
| SMILES | CCNCCOc1ccc(/C(=C(\Cl)c2ccccc2)c2ccccc2)cc1Cl.Cl |
| InChI | InChI=1S/C24H23Cl2NO.ClH/c1-2-27-15-16-28-22-14-13-20(17-21(22)25)23(18-9-5-3-6-10-18)24(26)19-11-7-4-8-12-19;/h3-14,17,27H,2,15-16H2,1H3;1H/b24-23-; |
| InChIKey | UAAPSYLPFHSZHT-DCXSSQDFSA-N |
| XLogP | 6.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|