C21H23N — CID 171382282
4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),4,6,9,11,13-hexaenylidene)-1-(trideuterio(113C)methyl)piperidine (PubChem CID 171382282) has the molecular formula C21H23N and a molecular weight of 293.43 g/mol. Its IUPAC name is 4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),4,6,9,11,13-hexaenylidene)-1-(trideuterio(113C)methyl)piperidine.
| Compound Name | 4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),4,6,9,11,13-hexaenylidene)-1-(trideuterio(113C)methyl)piperidine |
|---|---|
| PubChem CID | 171382282 |
| Molecular Formula | C21H23N |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),4,6,9,11,13-hexaenylidene)-1-(trideuterio(113C)methyl)piperidine |
| SMILES | [2H][13C]([2H])([2H])N1CCC(=C2c3ccccc3C=CC3C=CC=CC23)CC1 |
| InChI | InChI=1S/C21H23N/c1-22-14-12-18(13-15-22)21-19-8-4-2-6-16(19)10-11-17-7-3-5-9-20(17)21/h2-11,16,19H,12-15H2,1H3/i1+1D3 |
| InChIKey | IICYUMWQHFAHRH-KQORAOOSSA-N |
| XLogP | 4.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |