C16H16F2N2O4 — CID 171382876
3-(difluoromethoxy)-5-[1-(oxan-4-yl)pyrazol-4-yl]benzoic acid (PubChem CID 171382876) has the molecular formula C16H16F2N2O4 and a molecular weight of 338.31 g/mol. Its IUPAC name is 3-(difluoromethoxy)-5-[1-(oxan-4-yl)pyrazol-4-yl]benzoic acid.
| Compound Name | 3-(difluoromethoxy)-5-[1-(oxan-4-yl)pyrazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 171382876 |
| Molecular Formula | C16H16F2N2O4 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 3-(difluoromethoxy)-5-[1-(oxan-4-yl)pyrazol-4-yl]benzoic acid |
| SMILES | O=C(O)c1cc(OC(F)F)cc(-c2cnn(C3CCOCC3)c2)c1 |
| InChI | InChI=1S/C16H16F2N2O4/c17-16(18)24-14-6-10(5-11(7-14)15(21)22)12-8-19-20(9-12)13-1-3-23-4-2-13/h5-9,13,16H,1-4H2,(H,21,22) |
| InChIKey | AQGIGJAGVVOVSJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |