C94H110Cl2FN13O14S2 — CID 171383053
CID 171383053 (PubChem CID 171383053) has the molecular formula C94H110Cl2FN13O14S2 and a molecular weight of 1800.03 g/mol.
| Compound Name | CID 171383053 |
|---|---|
| PubChem CID | 171383053 |
| Molecular Formula | C94H110Cl2FN13O14S2 |
| Molecular Weight | 1800.03 g/mol |
| Exact Mass | 1797.71 |
| IUPAC Name | — |
| SMILES | CCN1C(C(=O)NC23CCC(C(=O)O)(CC2)CC3)C(c2cccc(Cl)c2F)C2(C(=O)Nc3cc(Cl)ccc32)C12CCCCC2.CNC(C)C(=O)NC1CN(S(=O)(=O)c2cccc(S(=O)(=O)N3CCC4CCC(C(=O)NC(c5ccccc5)c5ccccc5)N4C(=O)C(NC(=O)C(C)NC)C3)c2)CCC2CCC(C(=O)NC(c3ccccc3)c3ccccc3)N2C1=O |
| InChI | InChI=1S/C60H72N10O10S2.C34H38Cl2FN3O4/c1-39(61-3)55(71)63-49-37-67(34-32-45-28-30-51(69(45)59(49)75)57(73)65-53(41-18-9-5-10-19-41)42-20-11-6-12-21-42)81(77,78)47-26-17-27-48(36-47)82(79,80)68-35-33-46-29-31-52(70(46)60(76)50(38-68)64-56(72)40(2)62-4)58(74)66-54(43-22-13-7-14-23-43)44-24-15-8-16-25-44;1-2-40-27(28(41)39-32-16-13-31(14-17-32,15-18-32)30(43)44)25(21-7-6-8-23(36)26(21)37)34(33(40)11-4-3-5-12-33)22-10-9-20(35)19-24(22)38-29(34)42/h5-27,36,39-40,45-46,49-54,61-62H,28-35,37-38H2,1-4H3,(H,63,71)(H,64,72)(H,65,73)(H,66,74);6-10,19,25,27H,2-5,11-18H2,1H3,(H,38,42)(H,39,41)(H,43,44) |
| InChIKey | IKKLFQPLXOCLRB-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 354.58 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 126 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1800.03 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |