C7H11ClN4 — CID 171384041
6-chloro-2-imino-N,N,1-trimethylpyrimidin-4-amine (PubChem CID 171384041) has the molecular formula C7H11ClN4 and a molecular weight of 186.65 g/mol. Its IUPAC name is 6-chloro-2-imino-N,N,1-trimethylpyrimidin-4-amine.
| Compound Name | 6-chloro-2-imino-N,N,1-trimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 171384041 |
| Molecular Formula | C7H11ClN4 |
| Molecular Weight | 186.65 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 6-chloro-2-imino-N,N,1-trimethylpyrimidin-4-amine |
| SMILES | [H]/N=c1\nc(N(C)C)cc(Cl)n1C |
| InChI | InChI=1S/C7H11ClN4/c1-11(2)6-4-5(8)12(3)7(9)10-6/h4,9H,1-3H3/b9-7+ |
| InChIKey | BGTADJAFAVRPHY-VQHVLOKHSA-N |
| XLogP | 0.62 |
| TPSA | 44.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.65 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |