C9H7F3N2O — CID 171384209
7-(trifluoromethyl)-1,4-dihydroquinazolin-4-ol (PubChem CID 171384209) has the molecular formula C9H7F3N2O and a molecular weight of 216.16 g/mol. Its IUPAC name is 7-(trifluoromethyl)-1,4-dihydroquinazolin-4-ol.
| Compound Name | 7-(trifluoromethyl)-1,4-dihydroquinazolin-4-ol |
|---|---|
| PubChem CID | 171384209 |
| Molecular Formula | C9H7F3N2O |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 7-(trifluoromethyl)-1,4-dihydroquinazolin-4-ol |
| SMILES | OC1N=CNc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C9H7F3N2O/c10-9(11,12)5-1-2-6-7(3-5)13-4-14-8(6)15/h1-4,8,15H,(H,13,14) |
| InChIKey | UFDLCSUTXLWISC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |