C12H16N2O — CID 58798390
2-tert-butyl-1,4-dihydroquinazolin-4-ol (PubChem CID 58798390) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-tert-butyl-1,4-dihydroquinazolin-4-ol.
| Compound Name | 2-tert-butyl-1,4-dihydroquinazolin-4-ol |
|---|---|
| PubChem CID | 58798390 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-tert-butyl-1,4-dihydroquinazolin-4-ol |
| SMILES | CC(C)(C)C1=NC(O)c2ccccc2N1 |
| InChI | InChI=1S/C12H16N2O/c1-12(2,3)11-13-9-7-5-4-6-8(9)10(15)14-11/h4-7,10,15H,1-3H3,(H,13,14) |
| InChIKey | IZHXWYKZTCRXTA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |