C9H9N3O — CID 171384418
4-methyl-3-phenyl-1,2,4-oxadiazol-5-imine (PubChem CID 171384418) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 4-methyl-3-phenyl-1,2,4-oxadiazol-5-imine.
| Compound Name | 4-methyl-3-phenyl-1,2,4-oxadiazol-5-imine |
|---|---|
| PubChem CID | 171384418 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 4-methyl-3-phenyl-1,2,4-oxadiazol-5-imine |
| SMILES | [H]/N=c1\onc(-c2ccccc2)n1C |
| InChI | InChI=1S/C9H9N3O/c1-12-8(11-13-9(12)10)7-5-3-2-4-6-7/h2-6,10H,1H3/b10-9- |
| InChIKey | GSXHKNUUHRIRSG-KTKRTIGZSA-N |
| XLogP | 1.16 |
| TPSA | 54.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |