C8H14N4 — CID 171384672
N,N,1-trimethyl-2-methyliminopyrimidin-4-amine (PubChem CID 171384672) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is N,N,1-trimethyl-2-methyliminopyrimidin-4-amine.
| Compound Name | N,N,1-trimethyl-2-methyliminopyrimidin-4-amine |
|---|---|
| PubChem CID | 171384672 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | N,N,1-trimethyl-2-methyliminopyrimidin-4-amine |
| SMILES | C/N=c1\nc(N(C)C)ccn1C |
| InChI | InChI=1S/C8H14N4/c1-9-8-10-7(11(2)3)5-6-12(8)4/h5-6H,1-4H3/b9-8+ |
| InChIKey | VTYZNBCPJCHMMY-CMDGGOBGSA-N |
| XLogP | 0.02 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |