C5H10N4 — CID 143466155
1-methyl-2H-pyrimidine-2,4-diamine (PubChem CID 143466155) has the molecular formula C5H10N4 and a molecular weight of 126.16 g/mol. Its IUPAC name is 1-methyl-2H-pyrimidine-2,4-diamine.
| Compound Name | 1-methyl-2H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143466155 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 1-methyl-2H-pyrimidine-2,4-diamine |
| SMILES | CN1C=CC(N)=NC1N |
| InChI | InChI=1S/C5H10N4/c1-9-3-2-4(6)8-5(9)7/h2-3,5H,7H2,1H3,(H2,6,8) |
| InChIKey | KNPVGXJYFLKUPY-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |