C27H35N3O8S — CID 171387178
(3S,8R)-6-ethylsulfonyl-14,24-dimethoxy-2,12-dioxa-6,9,21-triazatetracyclo[21.2.2.113,17.03,8]octacosa-1(25),13,15,17(28),23,26-hexaene-10,20-dione (PubChem CID 171387178) has the molecular formula C27H35N3O8S and a molecular weight of 561.66 g/mol. Its IUPAC name is (3S,8R)-6-ethylsulfonyl-14,24-dimethoxy-2,12-dioxa-6,9,21-triazatetracyclo[21.2.2.113,17.03,8]octacosa-1(25),13,15,17(28),23,26-hexaene-10,20-dione.
| Compound Name | (3S,8R)-6-ethylsulfonyl-14,24-dimethoxy-2,12-dioxa-6,9,21-triazatetracyclo[21.2.2.113,17.03,8]octacosa-1(25),13,15,17(28),23,26-hexaene-10,20-dione |
|---|---|
| PubChem CID | 171387178 |
| Molecular Formula | C27H35N3O8S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | (3S,8R)-6-ethylsulfonyl-14,24-dimethoxy-2,12-dioxa-6,9,21-triazatetracyclo[21.2.2.113,17.03,8]octacosa-1(25),13,15,17(28),23,26-hexaene-10,20-dione |
| SMILES | CCS(=O)(=O)N1CC[C@@H]2Oc3ccc(c(OC)c3)CNC(=O)CCc3ccc(OC)c(c3)OCC(=O)N[C@@H]2C1 |
| InChI | InChI=1S/C27H35N3O8S/c1-4-39(33,34)30-12-11-22-21(16-30)29-27(32)17-37-25-13-18(5-9-23(25)35-2)6-10-26(31)28-15-19-7-8-20(38-22)14-24(19)36-3/h5,7-9,13-14,21-22H,4,6,10-12,15-17H2,1-3H3,(H,28,31)(H,29,32)/t21-,22+/m1/s1 |
| InChIKey | JLXFFFXJXNRWKD-YADHBBJMSA-N |
| XLogP | 1.63 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |