C34H39N3O6 — CID 169411717
(3S,8R)-14,24-dimethoxy-6-[(E)-3-phenylprop-2-enyl]-2,12-dioxa-6,9,21-triazatetracyclo[21.2.2.113,17.03,8]octacosa-1(25),13,15,17(28),23,26-hexaene-10,20-dione (PubChem CID 169411717) has the molecular formula C34H39N3O6 and a molecular weight of 585.70 g/mol. Its IUPAC name is (3S,8R)-14,24-dimethoxy-6-[(E)-3-phenylprop-2-enyl]-2,12-dioxa-6,9,21-triazatetracyclo[21.2.2.113,17.03,8]octacosa-1(25),13,15,17(28),23,26-hexaene-10,20-dione.
| Compound Name | (3S,8R)-14,24-dimethoxy-6-[(E)-3-phenylprop-2-enyl]-2,12-dioxa-6,9,21-triazatetracyclo[21.2.2.113,17.03,8]octacosa-1(25),13,15,17(28),23,26-hexaene-10,20-dione |
|---|---|
| PubChem CID | 169411717 |
| Molecular Formula | C34H39N3O6 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | (3S,8R)-14,24-dimethoxy-6-[(E)-3-phenylprop-2-enyl]-2,12-dioxa-6,9,21-triazatetracyclo[21.2.2.113,17.03,8]octacosa-1(25),13,15,17(28),23,26-hexaene-10,20-dione |
| SMILES | COc1cc2ccc1CNC(=O)CCc1ccc(OC)c(c1)OCC(=O)N[C@@H]1CN(C/C=C/c3ccccc3)CC[C@@H]1O2 |
| InChI | InChI=1S/C34H39N3O6/c1-40-30-14-10-25-11-15-33(38)35-21-26-12-13-27(20-31(26)41-2)43-29-16-18-37(17-6-9-24-7-4-3-5-8-24)22-28(29)36-34(39)23-42-32(30)19-25/h3-10,12-14,19-20,28-29H,11,15-18,21-23H2,1-2H3,(H,35,38)(H,36,39)/b9-6+/t28-,29+/m1/s1 |
| InChIKey | ZOQWWXQQDZHKJO-MOYAETCESA-N |
| XLogP | 4.00 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |