C21H22N4O4 — CID 171389760
2-(1,3-benzodioxol-5-ylmethyl)-4-[[(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]amino]-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-8-one (PubChem CID 171389760) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-4-[[(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]amino]-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-8-one.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-4-[[(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]amino]-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-8-one |
|---|---|
| PubChem CID | 171389760 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-4-[[(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]amino]-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-8-one |
| SMILES | O=C1NCCc2c(N[C@@H]3C[C@@H]4CC[C@H]3O4)nc(Cc3ccc4c(c3)OCO4)nc21 |
| InChI | InChI=1S/C21H22N4O4/c26-21-19-13(5-6-22-21)20(23-14-9-12-2-4-15(14)29-12)25-18(24-19)8-11-1-3-16-17(7-11)28-10-27-16/h1,3,7,12,14-15H,2,4-6,8-10H2,(H,22,26)(H,23,24,25)/t12-,14+,15+/m0/s1 |
| InChIKey | UOBHRSWWQVJMDW-NWANDNLSSA-N |
| XLogP | 1.81 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |