C21H11F5N2O3 — CID 171392025
6-(2,4-difluorophenyl)-1-hydroxy-3-[3-(trifluoromethyl)phenyl]quinazoline-2,4-dione (PubChem CID 171392025) has the molecular formula C21H11F5N2O3 and a molecular weight of 434.32 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)-1-hydroxy-3-[3-(trifluoromethyl)phenyl]quinazoline-2,4-dione.
| Compound Name | 6-(2,4-difluorophenyl)-1-hydroxy-3-[3-(trifluoromethyl)phenyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 171392025 |
| Molecular Formula | C21H11F5N2O3 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 6-(2,4-difluorophenyl)-1-hydroxy-3-[3-(trifluoromethyl)phenyl]quinazoline-2,4-dione |
| SMILES | O=c1c2cc(-c3ccc(F)cc3F)ccc2n(O)c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H11F5N2O3/c22-13-5-6-15(17(23)10-13)11-4-7-18-16(8-11)19(29)27(20(30)28(18)31)14-3-1-2-12(9-14)21(24,25)26/h1-10,31H |
| InChIKey | RABQFXPGEBVKJH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|