C18H14F4N4O3 — CID 22633025
6-fluoro-3-hydroxy-7-pyrrolidin-1-yl-1-[3-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 22633025) has the molecular formula C18H14F4N4O3 and a molecular weight of 410.33 g/mol. Its IUPAC name is 6-fluoro-3-hydroxy-7-pyrrolidin-1-yl-1-[3-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-fluoro-3-hydroxy-7-pyrrolidin-1-yl-1-[3-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22633025 |
| Molecular Formula | C18H14F4N4O3 |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 6-fluoro-3-hydroxy-7-pyrrolidin-1-yl-1-[3-(trifluoromethyl)phenyl]pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=c1c2cc(F)c(N3CCCC3)nc2n(-c2cccc(C(F)(F)F)c2)c(=O)n1O |
| InChI | InChI=1S/C18H14F4N4O3/c19-13-9-12-14(23-15(13)24-6-1-2-7-24)25(17(28)26(29)16(12)27)11-5-3-4-10(8-11)18(20,21)22/h3-5,8-9,29H,1-2,6-7H2 |
| InChIKey | KQYXNRRVEOTZAM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|